A nucleoside analogue found in Bacillus megaterium in which an adenine moiety is attached to position 2 of a of an oxetane ring which is substituted at positions 3 and 4 by hydroxymethyl groups.
Chemical formula | Net charge | Average mass |
---|---|---|
C10H13N5O3 | 0 | 251.24190 |
IUPAC | SMILES | InChI | InChIKey | Synonyms |
---|---|---|---|---|
[(2S,3R,4R)-4-(6-amino-9H-purin-9-yl)oxetane-2,3-diyl]dimethanol | Nc1ncnc2n(cnc12)[C@@H]1O[C@H](CO)[C@H]1CO | InChI=1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-5(1-16)6(2-17)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6-,10-/m1/s1 | LMJVXGOFWKVXAW-OXOINMOOSA-N |
|